C24H25F3N2 — CID 142609489
1-(2,6-difluoro-4-propylphenyl)-2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 142609489) has the molecular formula C24H25F3N2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 1-(2,6-difluoro-4-propylphenyl)-2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-(2,6-difluoro-4-propylphenyl)-2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 142609489 |
| Molecular Formula | C24H25F3N2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 1-(2,6-difluoro-4-propylphenyl)-2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCCc1cc(F)c(C2c3[nH]c4c(c3CCN2CC(C)(C)F)=C=C=CC=4)c(F)c1 |
| InChI | InChI=1S/C24H25F3N2/c1-4-7-15-12-18(25)21(19(26)13-15)23-22-17(10-11-29(23)14-24(2,3)27)16-8-5-6-9-20(16)28-22/h6,9,12-13,23,28H,4,7,10-11,14H2,1-3H3 |
| InChIKey | XLDUARXCOGDVKG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |