C22H25BrF3N3 — CID 145386607
6-(4-bromo-2,6-difluorophenyl)-7-(2-fluoro-2-methylpropyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline;ethane (PubChem CID 145386607) has the molecular formula C22H25BrF3N3 and a molecular weight of 468.36 g/mol. Its IUPAC name is 6-(4-bromo-2,6-difluorophenyl)-7-(2-fluoro-2-methylpropyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline;ethane.
| Compound Name | 6-(4-bromo-2,6-difluorophenyl)-7-(2-fluoro-2-methylpropyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline;ethane |
|---|---|
| PubChem CID | 145386607 |
| Molecular Formula | C22H25BrF3N3 |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 6-(4-bromo-2,6-difluorophenyl)-7-(2-fluoro-2-methylpropyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline;ethane |
| SMILES | CC.CC(C)(F)CN1CCc2c(ccc3[nH]ncc23)C1c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C20H19BrF3N3.C2H6/c1-20(2,24)10-27-6-5-12-13(3-4-17-14(12)9-25-26-17)19(27)18-15(22)7-11(21)8-16(18)23;1-2/h3-4,7-9,19H,5-6,10H2,1-2H3,(H,25,26);1-2H3 |
| InChIKey | YQVYNXDGIPOZOF-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |