About 4-propan-2-yl-6,7-dihydroquinoline
4-propan-2-yl-6,7-dihydroquinoline (PubChem CID 142610944) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 4-propan-2-yl-6,7-dihydroquinoline.
Molecular Properties
| Compound Name | 4-propan-2-yl-6,7-dihydroquinoline |
| PubChem CID | 142610944 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 4-propan-2-yl-6,7-dihydroquinoline |
| SMILES | CC(C)c1ccnc2c1=CCCC=2 |
| InChI | InChI=1S/C12H15N/c1-9(2)10-7-8-13-12-6-4-3-5-11(10)12/h5-9H,3-4H2,1-2H3 |
| InChIKey | XHMBYGNXMVAQSY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-propan-2-yl-6,7-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-6,7-dihydroquinoline?
The IUPAC name of 4-propan-2-yl-6,7-dihydroquinoline (CID 142610944) is 4-propan-2-yl-6,7-dihydroquinoline.
What is the SMILES notation for 4-propan-2-yl-6,7-dihydroquinoline?
The canonical SMILES for 4-propan-2-yl-6,7-dihydroquinoline is CC(C)c1ccnc2c1=CCCC=2.
What is the InChIKey of 4-propan-2-yl-6,7-dihydroquinoline?
The InChIKey is XHMBYGNXMVAQSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c1-9(2)10-7-8-13-12-6-4-3-5-11(10)12/h5-9H,3-4H2,1-2H3.
What are the key properties of 4-propan-2-yl-6,7-dihydroquinoline?
4-propan-2-yl-6,7-dihydroquinoline has a molecular weight of 173.26 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-6,7-dihydroquinoline is sourced from PubChem (CID 142610944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).