C22H20N6O3 — CID 142617571
3-cyclopropyl-6-(6-methoxy-7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)-[1,2,4]triazolo[3,4-a]phthalazine (PubChem CID 142617571) has the molecular formula C22H20N6O3 and a molecular weight of 416.44 g/mol. Its IUPAC name is 3-cyclopropyl-6-(6-methoxy-7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)-[1,2,4]triazolo[3,4-a]phthalazine.
| Compound Name | 3-cyclopropyl-6-(6-methoxy-7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)-[1,2,4]triazolo[3,4-a]phthalazine |
|---|---|
| PubChem CID | 142617571 |
| Molecular Formula | C22H20N6O3 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 3-cyclopropyl-6-(6-methoxy-7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)-[1,2,4]triazolo[3,4-a]phthalazine |
| SMILES | COc1cc2c(cc1[N+](=O)[O-])CN(c1nn3c(C4CC4)nnc3c3ccccc13)CC2 |
| InChI | InChI=1S/C22H20N6O3/c1-31-19-11-14-8-9-26(12-15(14)10-18(19)28(29)30)22-17-5-3-2-4-16(17)21-24-23-20(13-6-7-13)27(21)25-22/h2-5,10-11,13H,6-9,12H2,1H3 |
| InChIKey | XVJJRMAYWHOOFV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|