C47H37N5 — CID 142621951
2-[(E)-2-(4-phenylphenyl)prop-1-enyl]-5-[4-[2-phenyl-6-(3-pyridin-2-ylphenyl)-1,2-dihydro-1,3,5-triazin-4-yl]phenyl]aniline (PubChem CID 142621951) has the molecular formula C47H37N5 and a molecular weight of 671.85 g/mol. Its IUPAC name is 2-[(E)-2-(4-phenylphenyl)prop-1-enyl]-5-[4-[2-phenyl-6-(3-pyridin-2-ylphenyl)-1,2-dihydro-1,3,5-triazin-4-yl]phenyl]aniline.
| Compound Name | 2-[(E)-2-(4-phenylphenyl)prop-1-enyl]-5-[4-[2-phenyl-6-(3-pyridin-2-ylphenyl)-1,2-dihydro-1,3,5-triazin-4-yl]phenyl]aniline |
|---|---|
| PubChem CID | 142621951 |
| Molecular Formula | C47H37N5 |
| Molecular Weight | 671.85 g/mol |
| Exact Mass | 671.30 |
| IUPAC Name | 2-[(E)-2-(4-phenylphenyl)prop-1-enyl]-5-[4-[2-phenyl-6-(3-pyridin-2-ylphenyl)-1,2-dihydro-1,3,5-triazin-4-yl]phenyl]aniline |
| SMILES | C/C(=C\c1ccc(-c2ccc(C3=NC(c4ccccc4)NC(c4cccc(-c5ccccn5)c4)=N3)cc2)cc1N)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C47H37N5/c1-32(33-18-20-35(21-19-33)34-11-4-2-5-12-34)29-40-27-26-39(31-43(40)48)36-22-24-38(25-23-36)46-50-45(37-13-6-3-7-14-37)51-47(52-46)42-16-10-15-41(30-42)44-17-8-9-28-49-44/h2-31,45H,48H2,1H3,(H,50,51,52)/b32-29+ |
| InChIKey | KZUIVVCXMDDQIF-UUDCSCGESA-N |
| XLogP | 10.72 |
| TPSA | 75.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.85 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|