C16H23FN2 — CID 142624873
N-(2,3-dihydro-1H-inden-5-ylmethyl)-2-fluoropropan-1-imine;N-ethylmethanimine (PubChem CID 142624873) has the molecular formula C16H23FN2 and a molecular weight of 262.37 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-ylmethyl)-2-fluoropropan-1-imine;N-ethylmethanimine.
| Compound Name | N-(2,3-dihydro-1H-inden-5-ylmethyl)-2-fluoropropan-1-imine;N-ethylmethanimine |
|---|---|
| PubChem CID | 142624873 |
| Molecular Formula | C16H23FN2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-ylmethyl)-2-fluoropropan-1-imine;N-ethylmethanimine |
| SMILES | C=NCC.CC(F)/C=N/Cc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H16FN.C3H7N/c1-10(14)8-15-9-11-5-6-12-3-2-4-13(12)7-11;1-3-4-2/h5-8,10H,2-4,9H2,1H3;2-3H2,1H3/b15-8+; |
| InChIKey | VOEBBNIYYYIZGL-TWNLEINFSA-N |
| XLogP | 3.81 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|