About 6-nitrooxathiane
6-nitrooxathiane (PubChem CID 142632635) has the molecular formula C4H7NO3S
and a molecular weight of 149.17 g/mol. Its IUPAC name is 6-nitrooxathiane.
Molecular Properties
| Compound Name | 6-nitrooxathiane |
| PubChem CID | 142632635 |
| Molecular Formula | C4H7NO3S |
| Molecular Weight | 149.17 g/mol |
| Exact Mass | 149.01 |
| IUPAC Name | 6-nitrooxathiane |
| SMILES | O=[N+]([O-])C1CCCSO1 |
| InChI | InChI=1S/C4H7NO3S/c6-5(7)4-2-1-3-9-8-4/h4H,1-3H2 |
| InChIKey | UECNZXRJXJRGSX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.17 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitrooxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitrooxathiane?
The IUPAC name of 6-nitrooxathiane (CID 142632635) is 6-nitrooxathiane.
What is the SMILES notation for 6-nitrooxathiane?
The canonical SMILES for 6-nitrooxathiane is O=[N+]([O-])C1CCCSO1.
What is the InChIKey of 6-nitrooxathiane?
The InChIKey is UECNZXRJXJRGSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO3S/c6-5(7)4-2-1-3-9-8-4/h4H,1-3H2.
What are the key properties of 6-nitrooxathiane?
6-nitrooxathiane has a molecular weight of 149.17 g/mol, XLogP of 1.05, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitrooxathiane is sourced from PubChem (CID 142632635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).