C23H17NO5S — CID 142639265
4-[3-(2,3-dihydro-1-benzofuran-5-yl)-4-oxochromen-2-yl]benzenesulfonamide (PubChem CID 142639265) has the molecular formula C23H17NO5S and a molecular weight of 419.46 g/mol. Its IUPAC name is 4-[3-(2,3-dihydro-1-benzofuran-5-yl)-4-oxochromen-2-yl]benzenesulfonamide.
| Compound Name | 4-[3-(2,3-dihydro-1-benzofuran-5-yl)-4-oxochromen-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 142639265 |
| Molecular Formula | C23H17NO5S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 4-[3-(2,3-dihydro-1-benzofuran-5-yl)-4-oxochromen-2-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2oc3ccccc3c(=O)c2-c2ccc3c(c2)CCO3)cc1 |
| InChI | InChI=1S/C23H17NO5S/c24-30(26,27)17-8-5-14(6-9-17)23-21(16-7-10-19-15(13-16)11-12-28-19)22(25)18-3-1-2-4-20(18)29-23/h1-10,13H,11-12H2,(H2,24,26,27) |
| InChIKey | UPXRBBNOZUHQBQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |