C8H18N2O3 — CID 142648626
2-[(1S)-1,5-diaminopentyl]-1,3-dioxolan-2-ol (PubChem CID 142648626) has the molecular formula C8H18N2O3 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-[(1S)-1,5-diaminopentyl]-1,3-dioxolan-2-ol.
| Compound Name | 2-[(1S)-1,5-diaminopentyl]-1,3-dioxolan-2-ol |
|---|---|
| PubChem CID | 142648626 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | 2-[(1S)-1,5-diaminopentyl]-1,3-dioxolan-2-ol |
| SMILES | NCCCC[C@H](N)C1(O)OCCO1 |
| InChI | InChI=1S/C8H18N2O3/c9-4-2-1-3-7(10)8(11)12-5-6-13-8/h7,11H,1-6,9-10H2/t7-/m0/s1 |
| InChIKey | AXSHKPKGIGCETP-ZETCQYMHSA-N |
| XLogP | -0.86 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|