About 14-aminotetradecane-1,1-diol;oxirane
14-aminotetradecane-1,1-diol;oxirane (PubChem CID 87370530) has the molecular formula C16H35NO3
and a molecular weight of 289.46 g/mol. Its IUPAC name is 14-aminotetradecane-1,1-diol;oxirane.
Molecular Properties
| Compound Name | 14-aminotetradecane-1,1-diol;oxirane |
| PubChem CID | 87370530 |
| Molecular Formula | C16H35NO3 |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.26 |
| IUPAC Name | 14-aminotetradecane-1,1-diol;oxirane |
| SMILES | C1CO1.NCCCCCCCCCCCCCC(O)O |
| InChI | InChI=1S/C14H31NO2.C2H4O/c15-13-11-9-7-5-3-1-2-4-6-8-10-12-14(16)17;1-2-3-1/h14,16-17H,1-13,15H2;1-2H2 |
| InChIKey | PDMDTYJCZFXREN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 79.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 14-aminotetradecane-1,1-diol;oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 14-aminotetradecane-1,1-diol;oxirane?
The IUPAC name of 14-aminotetradecane-1,1-diol;oxirane (CID 87370530) is 14-aminotetradecane-1,1-diol;oxirane.
What is the SMILES notation for 14-aminotetradecane-1,1-diol;oxirane?
The canonical SMILES for 14-aminotetradecane-1,1-diol;oxirane is C1CO1.NCCCCCCCCCCCCCC(O)O.
What is the InChIKey of 14-aminotetradecane-1,1-diol;oxirane?
The InChIKey is PDMDTYJCZFXREN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31NO2.C2H4O/c15-13-11-9-7-5-3-1-2-4-6-8-10-12-14(16)17;1-2-3-1/h14,16-17H,1-13,15H2;1-2H2.
What are the key properties of 14-aminotetradecane-1,1-diol;oxirane?
14-aminotetradecane-1,1-diol;oxirane has a molecular weight of 289.46 g/mol, XLogP of 2.95, 13 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 14-aminotetradecane-1,1-diol;oxirane is sourced from PubChem (CID 87370530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).