About [(1R)-1,5-diaminopentyl]boronic acid
[(1R)-1,5-diaminopentyl]boronic acid (PubChem CID 5287803) has the molecular formula C5H15BN2O2
and a molecular weight of 146.00 g/mol. Its IUPAC name is [(1R)-1,5-diaminopentyl]boronic acid.
Molecular Properties
| Compound Name | [(1R)-1,5-diaminopentyl]boronic acid |
| PubChem CID | 5287803 |
| Molecular Formula | C5H15BN2O2 |
| Molecular Weight | 146.00 g/mol |
| Exact Mass | 146.12 |
| IUPAC Name | [(1R)-1,5-diaminopentyl]boronic acid |
| SMILES | NCCCC[C@H](N)B(O)O |
| InChI | InChI=1S/C5H15BN2O2/c7-4-2-1-3-5(8)6(9)10/h5,9-10H,1-4,7-8H2/t5-/m0/s1 |
| InChIKey | PZVAGZRLDYQMPS-YFKPBYRVSA-N |
| XLogP | -1.55 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.00 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1,5-diaminopentyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1,5-diaminopentyl]boronic acid?
The IUPAC name of [(1R)-1,5-diaminopentyl]boronic acid (CID 5287803) is [(1R)-1,5-diaminopentyl]boronic acid.
What is the SMILES notation for [(1R)-1,5-diaminopentyl]boronic acid?
The canonical SMILES for [(1R)-1,5-diaminopentyl]boronic acid is NCCCC[C@H](N)B(O)O.
What is the InChIKey of [(1R)-1,5-diaminopentyl]boronic acid?
The InChIKey is PZVAGZRLDYQMPS-YFKPBYRVSA-N. The full InChI is InChI=1S/C5H15BN2O2/c7-4-2-1-3-5(8)6(9)10/h5,9-10H,1-4,7-8H2/t5-/m0/s1.
What are the key properties of [(1R)-1,5-diaminopentyl]boronic acid?
[(1R)-1,5-diaminopentyl]boronic acid has a molecular weight of 146.00 g/mol, XLogP of -1.55, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1,5-diaminopentyl]boronic acid is sourced from PubChem (CID 5287803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).