About butylboronic acid;(6S)-heptane-1,6-diamine
butylboronic acid;(6S)-heptane-1,6-diamine (PubChem CID 145219482) has the molecular formula C11H29BN2O2
and a molecular weight of 232.18 g/mol. Its IUPAC name is butylboronic acid;(6S)-heptane-1,6-diamine.
Molecular Properties
| Compound Name | butylboronic acid;(6S)-heptane-1,6-diamine |
| PubChem CID | 145219482 |
| Molecular Formula | C11H29BN2O2 |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 232.23 |
| IUPAC Name | butylboronic acid;(6S)-heptane-1,6-diamine |
| SMILES | CCCCB(O)O.C[C@H](N)CCCCCN |
| InChI | InChI=1S/C7H18N2.C4H11BO2/c1-7(9)5-3-2-4-6-8;1-2-3-4-5(6)7/h7H,2-6,8-9H2,1H3;6-7H,2-4H2,1H3/t7-;/m0./s1 |
| InChIKey | ZYKCHKVEIOZVOZ-FJXQXJEOSA-N |
| XLogP | 1.11 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butylboronic acid;(6S)-heptane-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylboronic acid;(6S)-heptane-1,6-diamine?
The IUPAC name of butylboronic acid;(6S)-heptane-1,6-diamine (CID 145219482) is butylboronic acid;(6S)-heptane-1,6-diamine.
What is the SMILES notation for butylboronic acid;(6S)-heptane-1,6-diamine?
The canonical SMILES for butylboronic acid;(6S)-heptane-1,6-diamine is CCCCB(O)O.C[C@H](N)CCCCCN.
What is the InChIKey of butylboronic acid;(6S)-heptane-1,6-diamine?
The InChIKey is ZYKCHKVEIOZVOZ-FJXQXJEOSA-N. The full InChI is InChI=1S/C7H18N2.C4H11BO2/c1-7(9)5-3-2-4-6-8;1-2-3-4-5(6)7/h7H,2-6,8-9H2,1H3;6-7H,2-4H2,1H3/t7-;/m0./s1.
What are the key properties of butylboronic acid;(6S)-heptane-1,6-diamine?
butylboronic acid;(6S)-heptane-1,6-diamine has a molecular weight of 232.18 g/mol, XLogP of 1.11, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butylboronic acid;(6S)-heptane-1,6-diamine is sourced from PubChem (CID 145219482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).