C13H15N3S — CID 142665391
N-(1,2,3-benzothiadiazol-5-ylmethyl)cyclohex-3-en-1-amine (PubChem CID 142665391) has the molecular formula C13H15N3S and a molecular weight of 245.35 g/mol. Its IUPAC name is N-(1,2,3-benzothiadiazol-5-ylmethyl)cyclohex-3-en-1-amine.
| Compound Name | N-(1,2,3-benzothiadiazol-5-ylmethyl)cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 142665391 |
| Molecular Formula | C13H15N3S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | N-(1,2,3-benzothiadiazol-5-ylmethyl)cyclohex-3-en-1-amine |
| SMILES | C1=CCC(NCc2ccc3snnc3c2)CC1 |
| InChI | InChI=1S/C13H15N3S/c1-2-4-11(5-3-1)14-9-10-6-7-13-12(8-10)15-16-17-13/h1-2,6-8,11,14H,3-5,9H2 |
| InChIKey | XRXKCJSAWUOPQK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|