About (2-ethyl-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea
(2-ethyl-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea (PubChem CID 142666841) has the molecular formula C9H12N2OS
and a molecular weight of 196.28 g/mol. Its IUPAC name is (2-ethyl-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea.
Molecular Properties
| Compound Name | (2-ethyl-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea |
| PubChem CID | 142666841 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (2-ethyl-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea |
| SMILES | CCC1=CC=CC(=S)C1NC(N)=O |
| InChI | InChI=1S/C9H12N2OS/c1-2-6-4-3-5-7(13)8(6)11-9(10)12/h3-5,8H,2H2,1H3,(H3,10,11,12) |
| InChIKey | JOZDXICAVHIPQD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2-ethyl-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea?
The IUPAC name of (2-ethyl-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea (CID 142666841) is (2-ethyl-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea.
What is the SMILES notation for (2-ethyl-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea?
The canonical SMILES for (2-ethyl-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea is CCC1=CC=CC(=S)C1NC(N)=O.
What is the InChIKey of (2-ethyl-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea?
The InChIKey is JOZDXICAVHIPQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2OS/c1-2-6-4-3-5-7(13)8(6)11-9(10)12/h3-5,8H,2H2,1H3,(H3,10,11,12).
What are the key properties of (2-ethyl-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea?
(2-ethyl-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea has a molecular weight of 196.28 g/mol, XLogP of 1.30, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea is sourced from PubChem (CID 142666841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).