C8H10N2OS — CID 142666854
(4-sulfanylidenecyclohexa-1,5-dien-1-yl)methylurea (PubChem CID 142666854) has the molecular formula C8H10N2OS and a molecular weight of 182.25 g/mol. Its IUPAC name is (4-sulfanylidenecyclohexa-1,5-dien-1-yl)methylurea.
| Compound Name | (4-sulfanylidenecyclohexa-1,5-dien-1-yl)methylurea |
|---|---|
| PubChem CID | 142666854 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | (4-sulfanylidenecyclohexa-1,5-dien-1-yl)methylurea |
| SMILES | NC(=O)NCC1=CCC(=S)C=C1 |
| InChI | InChI=1S/C8H10N2OS/c9-8(11)10-5-6-1-3-7(12)4-2-6/h1-3H,4-5H2,(H3,9,10,11) |
| InChIKey | HSGIMTQHLWZICJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|