C9H14N2O — CID 138478221
(3-methylcyclohexa-1,5-dien-1-yl)methylurea (PubChem CID 138478221) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is (3-methylcyclohexa-1,5-dien-1-yl)methylurea.
| Compound Name | (3-methylcyclohexa-1,5-dien-1-yl)methylurea |
|---|---|
| PubChem CID | 138478221 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (3-methylcyclohexa-1,5-dien-1-yl)methylurea |
| SMILES | CC1C=C(CNC(N)=O)C=CC1 |
| InChI | InChI=1S/C9H14N2O/c1-7-3-2-4-8(5-7)6-11-9(10)12/h2,4-5,7H,3,6H2,1H3,(H3,10,11,12) |
| InChIKey | BQASAGXRRKWORC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |