C11H4F4N6O2 — CID 142671261
N-fluoro-N-(2,3,4-trifluoro-5-nitrophenyl)-7H-purin-2-amine (PubChem CID 142671261) has the molecular formula C11H4F4N6O2 and a molecular weight of 328.19 g/mol. Its IUPAC name is N-fluoro-N-(2,3,4-trifluoro-5-nitrophenyl)-7H-purin-2-amine.
| Compound Name | N-fluoro-N-(2,3,4-trifluoro-5-nitrophenyl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 142671261 |
| Molecular Formula | C11H4F4N6O2 |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | N-fluoro-N-(2,3,4-trifluoro-5-nitrophenyl)-7H-purin-2-amine |
| SMILES | O=[N+]([O-])c1cc(N(F)c2ncc3[nH]cnc3n2)c(F)c(F)c1F |
| InChI | InChI=1S/C11H4F4N6O2/c12-7-5(1-6(21(22)23)8(13)9(7)14)20(15)11-16-2-4-10(19-11)18-3-17-4/h1-3H,(H,16,17,18,19) |
| InChIKey | ARHULPYUMJSEMY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|