C5H7NOS — CID 142677150
(2R)-2-methyl-3-sulfanyl-1,2-dihydropyrrol-5-one (PubChem CID 142677150) has the molecular formula C5H7NOS and a molecular weight of 129.18 g/mol. Its IUPAC name is (2R)-2-methyl-3-sulfanyl-1,2-dihydropyrrol-5-one.
| Compound Name | (2R)-2-methyl-3-sulfanyl-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 142677150 |
| Molecular Formula | C5H7NOS |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.02 |
| IUPAC Name | (2R)-2-methyl-3-sulfanyl-1,2-dihydropyrrol-5-one |
| SMILES | C[C@H]1NC(=O)C=C1S |
| InChI | InChI=1S/C5H7NOS/c1-3-4(8)2-5(7)6-3/h2-3,8H,1H3,(H,6,7)/t3-/m1/s1 |
| InChIKey | GMXLLKKGAYOMDK-GSVOUGTGSA-N |
| XLogP | 0.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|