C25H35N5O5 — CID 142682919
2-[4-[2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]ethoxy]phenoxy]-2-methylpropanoic acid (PubChem CID 142682919) has the molecular formula C25H35N5O5 and a molecular weight of 485.59 g/mol. Its IUPAC name is 2-[4-[2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]ethoxy]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]ethoxy]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 142682919 |
| Molecular Formula | C25H35N5O5 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | 2-[4-[2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]ethoxy]phenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1ccc(OCCOc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc1)C(=O)O |
| InChI | InChI=1S/C25H35N5O5/c1-25(2,21(31)32)35-20-11-9-19(10-12-20)33-17-18-34-24-27-22(29-13-5-3-6-14-29)26-23(28-24)30-15-7-4-8-16-30/h9-12H,3-8,13-18H2,1-2H3,(H,31,32) |
| InChIKey | WLKLMAWMJFULEC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|