C15H18N2O3S2 — CID 142692182
2-(1-benzyl-6,7-dihydro-4H-thiopyrano[4,3-c]pyrazol-3-yl)ethanesulfonic acid (PubChem CID 142692182) has the molecular formula C15H18N2O3S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-(1-benzyl-6,7-dihydro-4H-thiopyrano[4,3-c]pyrazol-3-yl)ethanesulfonic acid.
| Compound Name | 2-(1-benzyl-6,7-dihydro-4H-thiopyrano[4,3-c]pyrazol-3-yl)ethanesulfonic acid |
|---|---|
| PubChem CID | 142692182 |
| Molecular Formula | C15H18N2O3S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 2-(1-benzyl-6,7-dihydro-4H-thiopyrano[4,3-c]pyrazol-3-yl)ethanesulfonic acid |
| SMILES | O=S(=O)(O)CCc1nn(Cc2ccccc2)c2c1CSCC2 |
| InChI | InChI=1S/C15H18N2O3S2/c18-22(19,20)9-7-14-13-11-21-8-6-15(13)17(16-14)10-12-4-2-1-3-5-12/h1-5H,6-11H2,(H,18,19,20) |
| InChIKey | CLQMDJIXZSYMKT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|