C19H28N2O2 — CID 143116778
1-benzyl-3-(dimethoxymethyl)-4,5,6,7-tetrahydroindazole;ethane (PubChem CID 143116778) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 1-benzyl-3-(dimethoxymethyl)-4,5,6,7-tetrahydroindazole;ethane.
| Compound Name | 1-benzyl-3-(dimethoxymethyl)-4,5,6,7-tetrahydroindazole;ethane |
|---|---|
| PubChem CID | 143116778 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 1-benzyl-3-(dimethoxymethyl)-4,5,6,7-tetrahydroindazole;ethane |
| SMILES | CC.COC(OC)c1nn(Cc2ccccc2)c2c1CCCC2 |
| InChI | InChI=1S/C17H22N2O2.C2H6/c1-20-17(21-2)16-14-10-6-7-11-15(14)19(18-16)12-13-8-4-3-5-9-13;1-2/h3-5,8-9,17H,6-7,10-12H2,1-2H3;1-2H3 |
| InChIKey | CGPHTFSRFYKDDQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|