C23H27N3O5S — CID 142692669
tert-butyl 4-[4-(1-benzofuran-2-ylsulfonylamino)phenyl]piperazine-1-carboxylate (PubChem CID 142692669) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is tert-butyl 4-[4-(1-benzofuran-2-ylsulfonylamino)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(1-benzofuran-2-ylsulfonylamino)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142692669 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | tert-butyl 4-[4-(1-benzofuran-2-ylsulfonylamino)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(NS(=O)(=O)c3cc4ccccc4o3)cc2)CC1 |
| InChI | InChI=1S/C23H27N3O5S/c1-23(2,3)31-22(27)26-14-12-25(13-15-26)19-10-8-18(9-11-19)24-32(28,29)21-16-17-6-4-5-7-20(17)30-21/h4-11,16,24H,12-15H2,1-3H3 |
| InChIKey | DZDQWYGUSWOHBL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|