C16H20INO2 — CID 142695696
(3R,6R,9aR)-3-iodo-6-(4-methoxyphenyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one (PubChem CID 142695696) has the molecular formula C16H20INO2 and a molecular weight of 385.25 g/mol. Its IUPAC name is (3R,6R,9aR)-3-iodo-6-(4-methoxyphenyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one.
| Compound Name | (3R,6R,9aR)-3-iodo-6-(4-methoxyphenyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
|---|---|
| PubChem CID | 142695696 |
| Molecular Formula | C16H20INO2 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | (3R,6R,9aR)-3-iodo-6-(4-methoxyphenyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
| SMILES | COc1ccc([C@H]2CCC[C@@H]3CC[C@@H](I)C(=O)N32)cc1 |
| InChI | InChI=1S/C16H20INO2/c1-20-13-8-5-11(6-9-13)15-4-2-3-12-7-10-14(17)16(19)18(12)15/h5-6,8-9,12,14-15H,2-4,7,10H2,1H3/t12-,14-,15-/m1/s1 |
| InChIKey | SCSQHDJYBVZETR-BPLDGKMQSA-N |
| XLogP | 3.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|