C6H10N2O2 — CID 142697377
2-amino-N-(2-oxobut-3-enyl)acetamide (PubChem CID 142697377) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is 2-amino-N-(2-oxobut-3-enyl)acetamide.
| Compound Name | 2-amino-N-(2-oxobut-3-enyl)acetamide |
|---|---|
| PubChem CID | 142697377 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 2-amino-N-(2-oxobut-3-enyl)acetamide |
| SMILES | C=CC(=O)CNC(=O)CN |
| InChI | InChI=1S/C6H10N2O2/c1-2-5(9)4-8-6(10)3-7/h2H,1,3-4,7H2,(H,8,10) |
| InChIKey | CGDRHAXDOJICQC-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|