C14H23N3O3 — CID 168969104
2-amino-N-[2-oxo-2-(2-oxopropylamino)ethyl]acetamide;(3Z)-3-methylhexa-1,3,5-triene (PubChem CID 168969104) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-amino-N-[2-oxo-2-(2-oxopropylamino)ethyl]acetamide;(3Z)-3-methylhexa-1,3,5-triene.
| Compound Name | 2-amino-N-[2-oxo-2-(2-oxopropylamino)ethyl]acetamide;(3Z)-3-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 168969104 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 2-amino-N-[2-oxo-2-(2-oxopropylamino)ethyl]acetamide;(3Z)-3-methylhexa-1,3,5-triene |
| SMILES | C=C/C=C(/C)C=C.CC(=O)CNC(=O)CNC(=O)CN |
| InChI | InChI=1S/C7H13N3O3.C7H10/c1-5(11)3-9-7(13)4-10-6(12)2-8;1-4-6-7(3)5-2/h2-4,8H2,1H3,(H,9,13)(H,10,12);4-6H,1-2H2,3H3/b;7-6- |
| InChIKey | XAYKIDGYRWXTAU-VDXOJYAPSA-N |
| XLogP | 0.07 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|