C26H27N3O3 — CID 142724919
1-(3,5-dimethoxyphenyl)-3-(2,2-dimethylchromen-6-yl)-2-phenylguanidine (PubChem CID 142724919) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-(2,2-dimethylchromen-6-yl)-2-phenylguanidine.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-(2,2-dimethylchromen-6-yl)-2-phenylguanidine |
|---|---|
| PubChem CID | 142724919 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-(2,2-dimethylchromen-6-yl)-2-phenylguanidine |
| SMILES | COc1cc(N/C(=N\c2ccccc2)Nc2ccc3c(c2)C=CC(C)(C)O3)cc(OC)c1 |
| InChI | InChI=1S/C26H27N3O3/c1-26(2)13-12-18-14-20(10-11-24(18)32-26)28-25(27-19-8-6-5-7-9-19)29-21-15-22(30-3)17-23(16-21)31-4/h5-17H,1-4H3,(H2,27,28,29) |
| InChIKey | ZXDNTEXYAAVNHY-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|