C20H20O6Se — CID 142747654
2-(3,4-dimethoxyphenyl)-5,6,7-trimethoxyselenochromen-4-one (PubChem CID 142747654) has the molecular formula C20H20O6Se and a molecular weight of 435.33 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5,6,7-trimethoxyselenochromen-4-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5,6,7-trimethoxyselenochromen-4-one |
|---|---|
| PubChem CID | 142747654 |
| Molecular Formula | C20H20O6Se |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5,6,7-trimethoxyselenochromen-4-one |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC)c(OC)c(OC)cc3[se]2)cc1OC |
| InChI | InChI=1S/C20H20O6Se/c1-22-13-7-6-11(8-14(13)23-2)16-9-12(21)18-17(27-16)10-15(24-3)19(25-4)20(18)26-5/h6-10H,1-5H3 |
| InChIKey | RGQWZRDVFZXYDZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|