C8H11FN4OS — CID 142758404
N'-amino-N-(6-amino-1-fluorocyclohexa-2,4-dien-1-yl)-2-sulfanylideneacetohydrazide (PubChem CID 142758404) has the molecular formula C8H11FN4OS and a molecular weight of 230.27 g/mol. Its IUPAC name is N'-amino-N-(6-amino-1-fluorocyclohexa-2,4-dien-1-yl)-2-sulfanylideneacetohydrazide.
| Compound Name | N'-amino-N-(6-amino-1-fluorocyclohexa-2,4-dien-1-yl)-2-sulfanylideneacetohydrazide |
|---|---|
| PubChem CID | 142758404 |
| Molecular Formula | C8H11FN4OS |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | N'-amino-N-(6-amino-1-fluorocyclohexa-2,4-dien-1-yl)-2-sulfanylideneacetohydrazide |
| SMILES | NNN(C(=O)C=S)C1(F)C=CC=CC1N |
| InChI | InChI=1S/C8H11FN4OS/c9-8(4-2-1-3-6(8)10)13(12-11)7(14)5-15/h1-6,12H,10-11H2 |
| InChIKey | QHIUMFDPZZZBSH-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|