C22H21F3N2O4 — CID 142762426
3-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]-(furan-2-ylmethyl)amino]propanoic acid (PubChem CID 142762426) has the molecular formula C22H21F3N2O4 and a molecular weight of 434.41 g/mol. Its IUPAC name is 3-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]-(furan-2-ylmethyl)amino]propanoic acid.
| Compound Name | 3-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]-(furan-2-ylmethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 142762426 |
| Molecular Formula | C22H21F3N2O4 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 3-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]-(furan-2-ylmethyl)amino]propanoic acid |
| SMILES | Cc1cc(C(=O)N(CCC(=O)O)Cc2ccco2)c(C)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C22H21F3N2O4/c1-14-12-17(15(2)27(14)19-8-4-3-7-18(19)22(23,24)25)21(30)26(10-9-20(28)29)13-16-6-5-11-31-16/h3-8,11-12H,9-10,13H2,1-2H3,(H,28,29) |
| InChIKey | KLWDDCUYLRTFDC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|