C23H23F3N2O2 — CID 59807955
N-ethyl-N-(5-hydroxy-2-methylphenyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide (PubChem CID 59807955) has the molecular formula C23H23F3N2O2 and a molecular weight of 416.44 g/mol. Its IUPAC name is N-ethyl-N-(5-hydroxy-2-methylphenyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | N-ethyl-N-(5-hydroxy-2-methylphenyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59807955 |
| Molecular Formula | C23H23F3N2O2 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | N-ethyl-N-(5-hydroxy-2-methylphenyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
| SMILES | CCN(C(=O)c1cc(C)n(-c2ccccc2C(F)(F)F)c1C)c1cc(O)ccc1C |
| InChI | InChI=1S/C23H23F3N2O2/c1-5-27(21-13-17(29)11-10-14(21)2)22(30)18-12-15(3)28(16(18)4)20-9-7-6-8-19(20)23(24,25)26/h6-13,29H,5H2,1-4H3 |
| InChIKey | UMPXVZILSIFUNE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|