C24H29ClN2O3 — CID 142770356
2-[2-[2-[(1-phenylcyclohexyl)amino]ethoxy]ethyl]isoindole-1,3-dione;hydrochloride (PubChem CID 142770356) has the molecular formula C24H29ClN2O3 and a molecular weight of 428.96 g/mol. Its IUPAC name is 2-[2-[2-[(1-phenylcyclohexyl)amino]ethoxy]ethyl]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[2-[2-[(1-phenylcyclohexyl)amino]ethoxy]ethyl]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 142770356 |
| Molecular Formula | C24H29ClN2O3 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 2-[2-[2-[(1-phenylcyclohexyl)amino]ethoxy]ethyl]isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1c2ccccc2C(=O)N1CCOCCNC1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C24H28N2O3.ClH/c27-22-20-11-5-6-12-21(20)23(28)26(22)16-18-29-17-15-25-24(13-7-2-8-14-24)19-9-3-1-4-10-19;/h1,3-6,9-12,25H,2,7-8,13-18H2;1H |
| InChIKey | AWKUUEUBWDOMDS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|