C26H29ClN2O6S — CID 142774912
benzyl 4-(benzenesulfonamido)pyrrolidine-2-carboxylate;benzyl formate;hydrochloride (PubChem CID 142774912) has the molecular formula C26H29ClN2O6S and a molecular weight of 533.05 g/mol. Its IUPAC name is benzyl 4-(benzenesulfonamido)pyrrolidine-2-carboxylate;benzyl formate;hydrochloride.
| Compound Name | benzyl 4-(benzenesulfonamido)pyrrolidine-2-carboxylate;benzyl formate;hydrochloride |
|---|---|
| PubChem CID | 142774912 |
| Molecular Formula | C26H29ClN2O6S |
| Molecular Weight | 533.05 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | benzyl 4-(benzenesulfonamido)pyrrolidine-2-carboxylate;benzyl formate;hydrochloride |
| SMILES | Cl.O=C(OCc1ccccc1)C1CC(NS(=O)(=O)c2ccccc2)CN1.O=COCc1ccccc1 |
| InChI | InChI=1S/C18H20N2O4S.C8H8O2.ClH/c21-18(24-13-14-7-3-1-4-8-14)17-11-15(12-19-17)20-25(22,23)16-9-5-2-6-10-16;9-7-10-6-8-4-2-1-3-5-8;/h1-10,15,17,19-20H,11-13H2;1-5,7H,6H2;1H |
| InChIKey | UCUAQVDAZSBTEV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.05 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|