C27H22N2O5S — CID 142776484
3-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]benzenesulfonamide (PubChem CID 142776484) has the molecular formula C27H22N2O5S and a molecular weight of 486.55 g/mol. Its IUPAC name is 3-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]benzenesulfonamide.
| Compound Name | 3-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 142776484 |
| Molecular Formula | C27H22N2O5S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 3-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]benzenesulfonamide |
| SMILES | COc1cc2nccc(Oc3ccc4c(-c5cccc(S(N)(=O)=O)c5)cccc4c3)c2cc1OC |
| InChI | InChI=1S/C27H22N2O5S/c1-32-26-15-23-24(16-27(26)33-2)29-12-11-25(23)34-19-9-10-22-17(13-19)6-4-8-21(22)18-5-3-7-20(14-18)35(28,30)31/h3-16H,1-2H3,(H2,28,30,31) |
| InChIKey | ATLHLOVDEUJBPR-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |