C17H10BrF4NO4 — CID 142797448
3-[[3-bromo-4-(trifluoromethoxy)anilino]methyl]-5-fluoro-1-benzofuran-2-carboxylic acid (PubChem CID 142797448) has the molecular formula C17H10BrF4NO4 and a molecular weight of 448.17 g/mol. Its IUPAC name is 3-[[3-bromo-4-(trifluoromethoxy)anilino]methyl]-5-fluoro-1-benzofuran-2-carboxylic acid.
| Compound Name | 3-[[3-bromo-4-(trifluoromethoxy)anilino]methyl]-5-fluoro-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 142797448 |
| Molecular Formula | C17H10BrF4NO4 |
| Molecular Weight | 448.17 g/mol |
| Exact Mass | 446.97 |
| IUPAC Name | 3-[[3-bromo-4-(trifluoromethoxy)anilino]methyl]-5-fluoro-1-benzofuran-2-carboxylic acid |
| SMILES | O=C(O)c1oc2ccc(F)cc2c1CNc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C17H10BrF4NO4/c18-12-6-9(2-4-14(12)27-17(20,21)22)23-7-11-10-5-8(19)1-3-13(10)26-15(11)16(24)25/h1-6,23H,7H2,(H,24,25) |
| InChIKey | MJYKVLLIJUYOSQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.17 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|