C41H68N2O5 — CID 142800246
ethyl 1-[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]hexyl]-4-oxopyrrolidine-3-carboxylate (PubChem CID 142800246) has the molecular formula C41H68N2O5 and a molecular weight of 669.00 g/mol. Its IUPAC name is ethyl 1-[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]hexyl]-4-oxopyrrolidine-3-carboxylate.
| Compound Name | ethyl 1-[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]hexyl]-4-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 142800246 |
| Molecular Formula | C41H68N2O5 |
| Molecular Weight | 669.00 g/mol |
| Exact Mass | 668.51 |
| IUPAC Name | ethyl 1-[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]hexyl]-4-oxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1CN(CCCCCCNC(=O)OC2CCC3(C)C(=CCC4C3CCC3(C)C(C(C)CCCC(C)C)CCC43)C2)CC1=O |
| InChI | InChI=1S/C41H68N2O5/c1-7-47-38(45)33-26-43(27-37(33)44)24-11-9-8-10-23-42-39(46)48-31-19-21-40(5)30(25-31)15-16-32-35-18-17-34(29(4)14-12-13-28(2)3)41(35,6)22-20-36(32)40/h15,28-29,31-36H,7-14,16-27H2,1-6H3,(H,42,46) |
| InChIKey | LLZKUTUOLUNZNU-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.00 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|