C12H15BN2O4 — CID 142800647
(7-ethoxy-2,3-dimethylquinoxalin-6-yl)oxyboronic acid (PubChem CID 142800647) has the molecular formula C12H15BN2O4 and a molecular weight of 262.07 g/mol. Its IUPAC name is (7-ethoxy-2,3-dimethylquinoxalin-6-yl)oxyboronic acid.
| Compound Name | (7-ethoxy-2,3-dimethylquinoxalin-6-yl)oxyboronic acid |
|---|---|
| PubChem CID | 142800647 |
| Molecular Formula | C12H15BN2O4 |
| Molecular Weight | 262.07 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (7-ethoxy-2,3-dimethylquinoxalin-6-yl)oxyboronic acid |
| SMILES | CCOc1cc2nc(C)c(C)nc2cc1OB(O)O |
| InChI | InChI=1S/C12H15BN2O4/c1-4-18-11-5-9-10(6-12(11)19-13(16)17)15-8(3)7(2)14-9/h5-6,16-17H,4H2,1-3H3 |
| InChIKey | JRDPIJRYYPDLEK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.07 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|