C18H27F2NO2S — CID 142806566
N-[(4E,6E,8E)-4-ethenyl-9-ethylsulfanyl-1-fluoro-3-hydroxy-7,8-dimethylnona-4,6,8-trien-2-yl]-2-fluoropropanamide (PubChem CID 142806566) has the molecular formula C18H27F2NO2S and a molecular weight of 359.48 g/mol. Its IUPAC name is N-[(4E,6E,8E)-4-ethenyl-9-ethylsulfanyl-1-fluoro-3-hydroxy-7,8-dimethylnona-4,6,8-trien-2-yl]-2-fluoropropanamide.
| Compound Name | N-[(4E,6E,8E)-4-ethenyl-9-ethylsulfanyl-1-fluoro-3-hydroxy-7,8-dimethylnona-4,6,8-trien-2-yl]-2-fluoropropanamide |
|---|---|
| PubChem CID | 142806566 |
| Molecular Formula | C18H27F2NO2S |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-[(4E,6E,8E)-4-ethenyl-9-ethylsulfanyl-1-fluoro-3-hydroxy-7,8-dimethylnona-4,6,8-trien-2-yl]-2-fluoropropanamide |
| SMILES | C=C/C(=C\C=C(C)\C(C)=C\SCC)C(O)C(CF)NC(=O)C(C)F |
| InChI | InChI=1S/C18H27F2NO2S/c1-6-15(9-8-12(3)13(4)11-24-7-2)17(22)16(10-19)21-18(23)14(5)20/h6,8-9,11,14,16-17,22H,1,7,10H2,2-5H3,(H,21,23)/b12-8+,13-11+,15-9+ |
| InChIKey | GYPHKAJNZXILED-BJVHEZQESA-N |
| XLogP | 3.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|