C19H23NOS — CID 14281273
8-(4-butoxyphenyl)sulfanyl-5,6,7,8-tetrahydroquinoline (PubChem CID 14281273) has the molecular formula C19H23NOS and a molecular weight of 313.47 g/mol. Its IUPAC name is 8-(4-butoxyphenyl)sulfanyl-5,6,7,8-tetrahydroquinoline.
| Compound Name | 8-(4-butoxyphenyl)sulfanyl-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 14281273 |
| Molecular Formula | C19H23NOS |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 8-(4-butoxyphenyl)sulfanyl-5,6,7,8-tetrahydroquinoline |
| SMILES | CCCCOc1ccc(SC2CCCc3cccnc32)cc1 |
| InChI | InChI=1S/C19H23NOS/c1-2-3-14-21-16-9-11-17(12-10-16)22-18-8-4-6-15-7-5-13-20-19(15)18/h5,7,9-13,18H,2-4,6,8,14H2,1H3 |
| InChIKey | LXXCTTXRIFAHKE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|