C15H16ClNS — CID 14281267
8-phenylsulfanyl-5,6,7,8-tetrahydroquinoline;hydrochloride (PubChem CID 14281267) has the molecular formula C15H16ClNS and a molecular weight of 277.82 g/mol. Its IUPAC name is 8-phenylsulfanyl-5,6,7,8-tetrahydroquinoline;hydrochloride.
| Compound Name | 8-phenylsulfanyl-5,6,7,8-tetrahydroquinoline;hydrochloride |
|---|---|
| PubChem CID | 14281267 |
| Molecular Formula | C15H16ClNS |
| Molecular Weight | 277.82 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 8-phenylsulfanyl-5,6,7,8-tetrahydroquinoline;hydrochloride |
| SMILES | Cl.c1ccc(SC2CCCc3cccnc32)cc1 |
| InChI | InChI=1S/C15H15NS.ClH/c1-2-8-13(9-3-1)17-14-10-4-6-12-7-5-11-16-15(12)14;/h1-3,5,7-9,11,14H,4,6,10H2;1H |
| InChIKey | GBPBDJGSNKRWLT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.82 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |