C38H76N2O8 — CID 142823471
(5S)-5-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-3-hydroxy-8-[[(4S)-4-hydroxy-5-methoxy-2,4-dimethylheptyl]amino]-2,4,6-trimethylnonanal;(4R)-4-methoxy-2,4-dimethyloxane (PubChem CID 142823471) has the molecular formula C38H76N2O8 and a molecular weight of 689.03 g/mol. Its IUPAC name is (5S)-5-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-3-hydroxy-8-[[(4S)-4-hydroxy-5-methoxy-2,4-dimethylheptyl]amino]-2,4,6-trimethylnonanal;(4R)-4-methoxy-2,4-dimethyloxane.
| Compound Name | (5S)-5-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-3-hydroxy-8-[[(4S)-4-hydroxy-5-methoxy-2,4-dimethylheptyl]amino]-2,4,6-trimethylnonanal;(4R)-4-methoxy-2,4-dimethyloxane |
|---|---|
| PubChem CID | 142823471 |
| Molecular Formula | C38H76N2O8 |
| Molecular Weight | 689.03 g/mol |
| Exact Mass | 688.56 |
| IUPAC Name | (5S)-5-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-3-hydroxy-8-[[(4S)-4-hydroxy-5-methoxy-2,4-dimethylheptyl]amino]-2,4,6-trimethylnonanal;(4R)-4-methoxy-2,4-dimethyloxane |
| SMILES | CCC(OC)[C@@](C)(O)CC(C)CNC(C)CC(C)[C@H](OC1CC(N(C)C)CC(C)O1)C(C)C(O)C(C)C=O.CO[C@]1(C)CCOC(C)C1 |
| InChI | InChI=1S/C30H60N2O6.C8H16O2/c1-12-26(36-11)30(8,35)16-19(2)17-31-22(5)13-20(3)29(24(7)28(34)21(4)18-33)38-27-15-25(32(9)10)14-23(6)37-27;1-7-6-8(2,9-3)4-5-10-7/h18-29,31,34-35H,12-17H2,1-11H3;7H,4-6H2,1-3H3/t19?,20?,21?,22?,23?,24?,25?,26?,27?,28?,29-,30-;7?,8-/m01/s1 |
| InChIKey | NHYNGIVKRYNGBJ-OZDPZIQHSA-N |
| XLogP | 5.46 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.03 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|