C33H64N2O6 — CID 142966701
(4S,6R,9R,11S,12R)-4-[(2R)-butan-2-yl]oxy-6-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-7-ethyl-12,13-dihydroxy-10-imino-3,7,9,11-tetramethylpentadecan-2-one (PubChem CID 142966701) has the molecular formula C33H64N2O6 and a molecular weight of 584.88 g/mol. Its IUPAC name is (4S,6R,9R,11S,12R)-4-[(2R)-butan-2-yl]oxy-6-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-7-ethyl-12,13-dihydroxy-10-imino-3,7,9,11-tetramethylpentadecan-2-one.
| Compound Name | (4S,6R,9R,11S,12R)-4-[(2R)-butan-2-yl]oxy-6-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-7-ethyl-12,13-dihydroxy-10-imino-3,7,9,11-tetramethylpentadecan-2-one |
|---|---|
| PubChem CID | 142966701 |
| Molecular Formula | C33H64N2O6 |
| Molecular Weight | 584.88 g/mol |
| Exact Mass | 584.48 |
| IUPAC Name | (4S,6R,9R,11S,12R)-4-[(2R)-butan-2-yl]oxy-6-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-7-ethyl-12,13-dihydroxy-10-imino-3,7,9,11-tetramethylpentadecan-2-one |
| SMILES | [H]/N=C(/[C@H](C)CC(C)(CC)[C@@H](C[C@H](O[C@H](C)CC)C(C)C(C)=O)OC1CC(N(C)C)CC(C)O1)[C@H](C)[C@@H](O)C(O)CC |
| InChI | InChI=1S/C33H64N2O6/c1-13-21(5)39-28(23(7)25(9)36)18-29(41-30-17-26(35(11)12)16-22(6)40-30)33(10,15-3)19-20(4)31(34)24(8)32(38)27(37)14-2/h20-24,26-30,32,34,37-38H,13-19H2,1-12H3/b34-31-/t20-,21-,22?,23?,24+,26?,27?,28+,29-,30?,32-,33?/m1/s1 |
| InChIKey | YGXKRBILHATAHB-WZWKJDLUSA-N |
| XLogP | 5.86 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.88 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|