C35H55NO4Si — CID 140700062
(2R,4R,5R,6S)-1-[tert-butyl(diphenyl)silyl]oxy-5-[(4S,6R)-4-(dimethylamino)-6-methyloxan-2-yl]oxy-2,4,6-trimethyloct-7-en-4-ol (PubChem CID 140700062) has the molecular formula C35H55NO4Si and a molecular weight of 581.91 g/mol. Its IUPAC name is (2R,4R,5R,6S)-1-[tert-butyl(diphenyl)silyl]oxy-5-[(4S,6R)-4-(dimethylamino)-6-methyloxan-2-yl]oxy-2,4,6-trimethyloct-7-en-4-ol.
| Compound Name | (2R,4R,5R,6S)-1-[tert-butyl(diphenyl)silyl]oxy-5-[(4S,6R)-4-(dimethylamino)-6-methyloxan-2-yl]oxy-2,4,6-trimethyloct-7-en-4-ol |
|---|---|
| PubChem CID | 140700062 |
| Molecular Formula | C35H55NO4Si |
| Molecular Weight | 581.91 g/mol |
| Exact Mass | 581.39 |
| IUPAC Name | (2R,4R,5R,6S)-1-[tert-butyl(diphenyl)silyl]oxy-5-[(4S,6R)-4-(dimethylamino)-6-methyloxan-2-yl]oxy-2,4,6-trimethyloct-7-en-4-ol |
| SMILES | C=C[C@H](C)[C@@H](OC1C[C@@H](N(C)C)C[C@@H](C)O1)[C@](C)(O)C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H55NO4Si/c1-11-27(3)33(40-32-23-29(36(9)10)22-28(4)39-32)35(8,37)24-26(2)25-38-41(34(5,6)7,30-18-14-12-15-19-30)31-20-16-13-17-21-31/h11-21,26-29,32-33,37H,1,22-25H2,2-10H3/t26-,27+,28-,29+,32?,33-,35-/m1/s1 |
| InChIKey | LLUQMNYUOLTBAU-NEMNQXBYSA-N |
| XLogP | 6.00 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.91 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|