C24H38N4O3S2 — CID 142830504
tert-butyl N-[2-[4-[[(E)-[amino(cyclohexylmethylsulfanyl)methylidene]carbamothioyl]amino]phenoxy]ethyl]-N-ethylcarbamate (PubChem CID 142830504) has the molecular formula C24H38N4O3S2 and a molecular weight of 494.73 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[[(E)-[amino(cyclohexylmethylsulfanyl)methylidene]carbamothioyl]amino]phenoxy]ethyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[2-[4-[[(E)-[amino(cyclohexylmethylsulfanyl)methylidene]carbamothioyl]amino]phenoxy]ethyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 142830504 |
| Molecular Formula | C24H38N4O3S2 |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | tert-butyl N-[2-[4-[[(E)-[amino(cyclohexylmethylsulfanyl)methylidene]carbamothioyl]amino]phenoxy]ethyl]-N-ethylcarbamate |
| SMILES | CCN(CCOc1ccc(NC(=S)/N=C(\N)SCC2CCCCC2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H38N4O3S2/c1-5-28(23(29)31-24(2,3)4)15-16-30-20-13-11-19(12-14-20)26-22(32)27-21(25)33-17-18-9-7-6-8-10-18/h11-14,18H,5-10,15-17H2,1-4H3,(H3,25,26,27,32) |
| InChIKey | OPGANBDYBBECHJ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|