C28H49BrN4OS2 — CID 142830572
bromoethane;(Z)-but-2-ene;(1-methylcyclohexyl)methyl N'-[[4-[2-(dimethylamino)-2-methylpropoxy]phenyl]carbamothioyl]carbamimidothioate (PubChem CID 142830572) has the molecular formula C28H49BrN4OS2 and a molecular weight of 601.77 g/mol. Its IUPAC name is bromoethane;(Z)-but-2-ene;(1-methylcyclohexyl)methyl N'-[[4-[2-(dimethylamino)-2-methylpropoxy]phenyl]carbamothioyl]carbamimidothioate.
| Compound Name | bromoethane;(Z)-but-2-ene;(1-methylcyclohexyl)methyl N'-[[4-[2-(dimethylamino)-2-methylpropoxy]phenyl]carbamothioyl]carbamimidothioate |
|---|---|
| PubChem CID | 142830572 |
| Molecular Formula | C28H49BrN4OS2 |
| Molecular Weight | 601.77 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | bromoethane;(Z)-but-2-ene;(1-methylcyclohexyl)methyl N'-[[4-[2-(dimethylamino)-2-methylpropoxy]phenyl]carbamothioyl]carbamimidothioate |
| SMILES | C/C=C\C.CCBr.CN(C)C(C)(C)COc1ccc(NC(=S)/N=C(\N)SCC2(C)CCCCC2)cc1 |
| InChI | InChI=1S/C22H36N4OS2.C4H8.C2H5Br/c1-21(2,26(4)5)15-27-18-11-9-17(10-12-18)24-20(28)25-19(23)29-16-22(3)13-7-6-8-14-22;1-3-4-2;1-2-3/h9-12H,6-8,13-16H2,1-5H3,(H3,23,24,25,28);3-4H,1-2H3;2H2,1H3/b;4-3-; |
| InChIKey | JRIWTMZQOTVNFO-LWFKIUJUSA-N |
| XLogP | 8.10 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.77 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|