C22H38N4OS2 — CID 142830477
(2-ethyl-2-methylhexyl) N'-[[4-[2-(dimethylamino)propoxy]phenyl]carbamothioyl]carbamimidothioate (PubChem CID 142830477) has the molecular formula C22H38N4OS2 and a molecular weight of 438.71 g/mol. Its IUPAC name is (2-ethyl-2-methylhexyl) N'-[[4-[2-(dimethylamino)propoxy]phenyl]carbamothioyl]carbamimidothioate.
| Compound Name | (2-ethyl-2-methylhexyl) N'-[[4-[2-(dimethylamino)propoxy]phenyl]carbamothioyl]carbamimidothioate |
|---|---|
| PubChem CID | 142830477 |
| Molecular Formula | C22H38N4OS2 |
| Molecular Weight | 438.71 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | (2-ethyl-2-methylhexyl) N'-[[4-[2-(dimethylamino)propoxy]phenyl]carbamothioyl]carbamimidothioate |
| SMILES | CCCCC(C)(CC)CS/C(N)=N/C(=S)Nc1ccc(OCC(C)N(C)C)cc1 |
| InChI | InChI=1S/C22H38N4OS2/c1-7-9-14-22(4,8-2)16-29-20(23)25-21(28)24-18-10-12-19(13-11-18)27-15-17(3)26(5)6/h10-13,17H,7-9,14-16H2,1-6H3,(H3,23,24,25,28) |
| InChIKey | ZJNQFOJNEVFASB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.71 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|