C27H43BrN4OS2 — CID 142830647
1-bicyclo[4.1.0]hept-5-enylmethyl N'-[[4-[2-(dimethylamino)propoxy]phenyl]carbamothioyl]carbamimidothioate;bromoethane;(Z)-but-2-ene (PubChem CID 142830647) has the molecular formula C27H43BrN4OS2 and a molecular weight of 583.71 g/mol. Its IUPAC name is 1-bicyclo[4.1.0]hept-5-enylmethyl N'-[[4-[2-(dimethylamino)propoxy]phenyl]carbamothioyl]carbamimidothioate;bromoethane;(Z)-but-2-ene.
| Compound Name | 1-bicyclo[4.1.0]hept-5-enylmethyl N'-[[4-[2-(dimethylamino)propoxy]phenyl]carbamothioyl]carbamimidothioate;bromoethane;(Z)-but-2-ene |
|---|---|
| PubChem CID | 142830647 |
| Molecular Formula | C27H43BrN4OS2 |
| Molecular Weight | 583.71 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | 1-bicyclo[4.1.0]hept-5-enylmethyl N'-[[4-[2-(dimethylamino)propoxy]phenyl]carbamothioyl]carbamimidothioate;bromoethane;(Z)-but-2-ene |
| SMILES | C/C=C\C.CC(COc1ccc(NC(=S)/N=C(\N)SCC23CCCC=C2C3)cc1)N(C)C.CCBr |
| InChI | InChI=1S/C21H30N4OS2.C4H8.C2H5Br/c1-15(25(2)3)13-26-18-9-7-17(8-10-18)23-20(27)24-19(22)28-14-21-11-5-4-6-16(21)12-21;1-3-4-2;1-2-3/h6-10,15H,4-5,11-14H2,1-3H3,(H3,22,23,24,27);3-4H,1-2H3;2H2,1H3/b;4-3-; |
| InChIKey | XOVVPPKABJTMFW-LWFKIUJUSA-N |
| XLogP | 7.24 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.71 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|