C36H53BrN4O3S2 — CID 142830562
2-bromo-1-(4-hydroxy-3-propylphenyl)ethanone;ethane;(7-methyl-1-bicyclo[4.1.1]oct-5-enyl)methyl N'-[[4-[2-(dimethylamino)propoxy]phenyl]carbamothioyl]carbamimidothioate (PubChem CID 142830562) has the molecular formula C36H53BrN4O3S2 and a molecular weight of 733.88 g/mol. Its IUPAC name is 2-bromo-1-(4-hydroxy-3-propylphenyl)ethanone;ethane;(7-methyl-1-bicyclo[4.1.1]oct-5-enyl)methyl N'-[[4-[2-(dimethylamino)propoxy]phenyl]carbamothioyl]carbamimidothioate.
| Compound Name | 2-bromo-1-(4-hydroxy-3-propylphenyl)ethanone;ethane;(7-methyl-1-bicyclo[4.1.1]oct-5-enyl)methyl N'-[[4-[2-(dimethylamino)propoxy]phenyl]carbamothioyl]carbamimidothioate |
|---|---|
| PubChem CID | 142830562 |
| Molecular Formula | C36H53BrN4O3S2 |
| Molecular Weight | 733.88 g/mol |
| Exact Mass | 732.27 |
| IUPAC Name | 2-bromo-1-(4-hydroxy-3-propylphenyl)ethanone;ethane;(7-methyl-1-bicyclo[4.1.1]oct-5-enyl)methyl N'-[[4-[2-(dimethylamino)propoxy]phenyl]carbamothioyl]carbamimidothioate |
| SMILES | CC.CC(COc1ccc(NC(=S)/N=C(\N)SCC23CCCC=C(C2)C3C)cc1)N(C)C.CCCc1cc(C(=O)CBr)ccc1O |
| InChI | InChI=1S/C23H34N4OS2.C11H13BrO2.C2H6/c1-16(27(3)4)14-28-20-10-8-19(9-11-20)25-22(29)26-21(24)30-15-23-12-6-5-7-18(13-23)17(23)2;1-2-3-8-6-9(11(14)7-12)4-5-10(8)13;1-2/h7-11,16-17H,5-6,12-15H2,1-4H3,(H3,24,25,26,29);4-6,13H,2-3,7H2,1H3;1-2H3 |
| InChIKey | XVNFUKPEOWCRDS-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.88 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|