C23H36N4OS2 — CID 142830589
(1-methylcyclohept-3-en-1-yl)methyl N'-[[4-[2-(dimethylamino)-2-methylpropoxy]phenyl]carbamothioyl]carbamimidothioate (PubChem CID 142830589) has the molecular formula C23H36N4OS2 and a molecular weight of 448.70 g/mol. Its IUPAC name is (1-methylcyclohept-3-en-1-yl)methyl N'-[[4-[2-(dimethylamino)-2-methylpropoxy]phenyl]carbamothioyl]carbamimidothioate.
| Compound Name | (1-methylcyclohept-3-en-1-yl)methyl N'-[[4-[2-(dimethylamino)-2-methylpropoxy]phenyl]carbamothioyl]carbamimidothioate |
|---|---|
| PubChem CID | 142830589 |
| Molecular Formula | C23H36N4OS2 |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | (1-methylcyclohept-3-en-1-yl)methyl N'-[[4-[2-(dimethylamino)-2-methylpropoxy]phenyl]carbamothioyl]carbamimidothioate |
| SMILES | CN(C)C(C)(C)COc1ccc(NC(=S)/N=C(\N)SCC2(C)CC=CCCC2)cc1 |
| InChI | InChI=1S/C23H36N4OS2/c1-22(2,27(4)5)16-28-19-12-10-18(11-13-19)25-21(29)26-20(24)30-17-23(3)14-8-6-7-9-15-23/h6,8,10-13H,7,9,14-17H2,1-5H3,(H3,24,25,26,29) |
| InChIKey | PFSPFRKPELPQKX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|