C15H24N4OS2 — CID 23525752
ethyl N'-[[4-[2-(dimethylamino)propoxy]phenyl]carbamothioyl]carbamimidothioate (PubChem CID 23525752) has the molecular formula C15H24N4OS2 and a molecular weight of 340.52 g/mol. Its IUPAC name is ethyl N'-[[4-[2-(dimethylamino)propoxy]phenyl]carbamothioyl]carbamimidothioate.
| Compound Name | ethyl N'-[[4-[2-(dimethylamino)propoxy]phenyl]carbamothioyl]carbamimidothioate |
|---|---|
| PubChem CID | 23525752 |
| Molecular Formula | C15H24N4OS2 |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | ethyl N'-[[4-[2-(dimethylamino)propoxy]phenyl]carbamothioyl]carbamimidothioate |
| SMILES | CCS/C(N)=N/C(=S)Nc1ccc(OCC(C)N(C)C)cc1 |
| InChI | InChI=1S/C15H24N4OS2/c1-5-22-14(16)18-15(21)17-12-6-8-13(9-7-12)20-10-11(2)19(3)4/h6-9,11H,5,10H2,1-4H3,(H3,16,17,18,21) |
| InChIKey | QQNTXUBCFBRQJV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|