C18H20N6O2S — CID 142839165
2-(1,7-dimethyl-6-oxo-8-piperazin-1-ylpurin-2-yl)sulfanylbenzaldehyde (PubChem CID 142839165) has the molecular formula C18H20N6O2S and a molecular weight of 384.47 g/mol. Its IUPAC name is 2-(1,7-dimethyl-6-oxo-8-piperazin-1-ylpurin-2-yl)sulfanylbenzaldehyde.
| Compound Name | 2-(1,7-dimethyl-6-oxo-8-piperazin-1-ylpurin-2-yl)sulfanylbenzaldehyde |
|---|---|
| PubChem CID | 142839165 |
| Molecular Formula | C18H20N6O2S |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-(1,7-dimethyl-6-oxo-8-piperazin-1-ylpurin-2-yl)sulfanylbenzaldehyde |
| SMILES | Cn1c(Sc2ccccc2C=O)nc2nc(N3CCNCC3)n(C)c2c1=O |
| InChI | InChI=1S/C18H20N6O2S/c1-22-14-15(20-17(22)24-9-7-19-8-10-24)21-18(23(2)16(14)26)27-13-6-4-3-5-12(13)11-25/h3-6,11,19H,7-10H2,1-2H3 |
| InChIKey | RVACDTAQOXCDJH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|